C30H31F2N3O4 — CID 163235137
N-[(2,4-difluorophenyl)methyl]-6-formyl-4-oxo-5-phenylmethoxy-1-(1,3,7-trimethyl-4,7-dihydro-2H-azepin-3-yl)pyridine-3-carboxamide (PubChem CID 163235137) has the molecular formula C30H31F2N3O4 and a molecular weight of 535.59 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-6-formyl-4-oxo-5-phenylmethoxy-1-(1,3,7-trimethyl-4,7-dihydro-2H-azepin-3-yl)pyridine-3-carboxamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-6-formyl-4-oxo-5-phenylmethoxy-1-(1,3,7-trimethyl-4,7-dihydro-2H-azepin-3-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 163235137 |
| Molecular Formula | C30H31F2N3O4 |
| Molecular Weight | 535.59 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-6-formyl-4-oxo-5-phenylmethoxy-1-(1,3,7-trimethyl-4,7-dihydro-2H-azepin-3-yl)pyridine-3-carboxamide |
| SMILES | CC1C=CCC(C)(n2cc(C(=O)NCc3ccc(F)cc3F)c(=O)c(OCc3ccccc3)c2C=O)CN1C |
| InChI | InChI=1S/C30H31F2N3O4/c1-20-8-7-13-30(2,19-34(20)3)35-16-24(29(38)33-15-22-11-12-23(31)14-25(22)32)27(37)28(26(35)17-36)39-18-21-9-5-4-6-10-21/h4-12,14,16-17,20H,13,15,18-19H2,1-3H3,(H,33,38) |
| InChIKey | FARSFVHCMZMYIK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.59 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|