C21H20N2O5 — CID 163235159
(1S,10S)-10-methyl-5,8-dioxo-6-phenylmethoxy-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxylic acid (PubChem CID 163235159) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is (1S,10S)-10-methyl-5,8-dioxo-6-phenylmethoxy-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxylic acid.
| Compound Name | (1S,10S)-10-methyl-5,8-dioxo-6-phenylmethoxy-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxylic acid |
|---|---|
| PubChem CID | 163235159 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | (1S,10S)-10-methyl-5,8-dioxo-6-phenylmethoxy-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxylic acid |
| SMILES | C[C@H]1C=CC[C@H]2CN1C(=O)c1c(OCc3ccccc3)c(=O)c(C(=O)O)cn12 |
| InChI | InChI=1S/C21H20N2O5/c1-13-6-5-9-15-10-22(13)20(25)17-19(28-12-14-7-3-2-4-8-14)18(24)16(21(26)27)11-23(15)17/h2-8,11,13,15H,9-10,12H2,1H3,(H,26,27)/t13-,15-/m0/s1 |
| InChIKey | HLRCBAGQYRLBRV-ZFWWWQNUSA-N |
| XLogP | 2.47 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|