C29H27F2N3O5 — CID 163235271
(1R,10S,13S)-N-[(2,4-difluorophenyl)methyl]-10-methyl-5,8-dioxo-6-phenylmethoxy-13-(trideuteriomethoxy)-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide (PubChem CID 163235271) has the molecular formula C29H27F2N3O5 and a molecular weight of 538.57 g/mol. Its IUPAC name is (1R,10S,13S)-N-[(2,4-difluorophenyl)methyl]-10-methyl-5,8-dioxo-6-phenylmethoxy-13-(trideuteriomethoxy)-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide.
| Compound Name | (1R,10S,13S)-N-[(2,4-difluorophenyl)methyl]-10-methyl-5,8-dioxo-6-phenylmethoxy-13-(trideuteriomethoxy)-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide |
|---|---|
| PubChem CID | 163235271 |
| Molecular Formula | C29H27F2N3O5 |
| Molecular Weight | 538.57 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | (1R,10S,13S)-N-[(2,4-difluorophenyl)methyl]-10-methyl-5,8-dioxo-6-phenylmethoxy-13-(trideuteriomethoxy)-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,11-triene-4-carboxamide |
| SMILES | [2H]C([2H])([2H])O[C@H]1C=C[C@H](C)N2C[C@H]1n1cc(C(=O)NCc3ccc(F)cc3F)c(=O)c(OCc3ccccc3)c1C2=O |
| InChI | InChI=1S/C29H27F2N3O5/c1-17-8-11-24(38-2)23-15-33(17)29(37)25-27(39-16-18-6-4-3-5-7-18)26(35)21(14-34(23)25)28(36)32-13-19-9-10-20(30)12-22(19)31/h3-12,14,17,23-24H,13,15-16H2,1-2H3,(H,32,36)/t17-,23+,24-/m0/s1/i2D3 |
| InChIKey | HGYROWUEZNGACX-HBFSYQOPSA-N |
| XLogP | 3.61 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.57 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|