C27H26F2N4O4 — CID 142367232
N-[(2,4-difluorophenyl)methyl]-3-ethyl-4,7-dioxo-6-phenylmethoxy-1,3,13-triazatricyclo[7.3.1.05,13]trideca-5,8-diene-8-carboxamide (PubChem CID 142367232) has the molecular formula C27H26F2N4O4 and a molecular weight of 508.53 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-3-ethyl-4,7-dioxo-6-phenylmethoxy-1,3,13-triazatricyclo[7.3.1.05,13]trideca-5,8-diene-8-carboxamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-3-ethyl-4,7-dioxo-6-phenylmethoxy-1,3,13-triazatricyclo[7.3.1.05,13]trideca-5,8-diene-8-carboxamide |
|---|---|
| PubChem CID | 142367232 |
| Molecular Formula | C27H26F2N4O4 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-3-ethyl-4,7-dioxo-6-phenylmethoxy-1,3,13-triazatricyclo[7.3.1.05,13]trideca-5,8-diene-8-carboxamide |
| SMILES | CCN1CN2CCCc3c(C(=O)NCc4ccc(F)cc4F)c(=O)c(OCc4ccccc4)c(n32)C1=O |
| InChI | InChI=1S/C27H26F2N4O4/c1-2-31-16-32-12-6-9-21-22(26(35)30-14-18-10-11-19(28)13-20(18)29)24(34)25(23(27(31)36)33(21)32)37-15-17-7-4-3-5-8-17/h3-5,7-8,10-11,13H,2,6,9,12,14-16H2,1H3,(H,30,35) |
| InChIKey | OLJKSEZCMXETCC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |