C29H27F2N3O5 — CID 153440018
N-[(2,4-difluorophenyl)methyl]-2-methyl-8,11-dioxo-10-phenylmethoxy-3-oxa-7,16-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-9,12-diene-12-carboxamide (PubChem CID 153440018) has the molecular formula C29H27F2N3O5 and a molecular weight of 535.55 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-2-methyl-8,11-dioxo-10-phenylmethoxy-3-oxa-7,16-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-9,12-diene-12-carboxamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-2-methyl-8,11-dioxo-10-phenylmethoxy-3-oxa-7,16-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-9,12-diene-12-carboxamide |
|---|---|
| PubChem CID | 153440018 |
| Molecular Formula | C29H27F2N3O5 |
| Molecular Weight | 535.55 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-2-methyl-8,11-dioxo-10-phenylmethoxy-3-oxa-7,16-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-9,12-diene-12-carboxamide |
| SMILES | CC12OCCCN1C(=O)c1c(OCc3ccccc3)c(=O)c(C(=O)NCc3ccc(F)cc3F)c3n1C2CC3 |
| InChI | InChI=1S/C29H27F2N3O5/c1-29-22-11-10-21-23(27(36)32-15-18-8-9-19(30)14-20(18)31)25(35)26(38-16-17-6-3-2-4-7-17)24(34(21)22)28(37)33(29)12-5-13-39-29/h2-4,6-9,14,22H,5,10-13,15-16H2,1H3,(H,32,36) |
| InChIKey | QFYJGHDYIUKETH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |