C22H25F2N3O4 — CID 145346453
(4R)-N-[(2,4-difluorophenyl)methyl]-6-ethyl-9-hydroxy-7,10-dioxo-6,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),8-diene-11-carboxamide;ethane (PubChem CID 145346453) has the molecular formula C22H25F2N3O4 and a molecular weight of 433.46 g/mol. Its IUPAC name is (4R)-N-[(2,4-difluorophenyl)methyl]-6-ethyl-9-hydroxy-7,10-dioxo-6,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),8-diene-11-carboxamide;ethane.
| Compound Name | (4R)-N-[(2,4-difluorophenyl)methyl]-6-ethyl-9-hydroxy-7,10-dioxo-6,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),8-diene-11-carboxamide;ethane |
|---|---|
| PubChem CID | 145346453 |
| Molecular Formula | C22H25F2N3O4 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | (4R)-N-[(2,4-difluorophenyl)methyl]-6-ethyl-9-hydroxy-7,10-dioxo-6,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),8-diene-11-carboxamide;ethane |
| SMILES | CC.CCN1C[C@H]2CCc3c(C(=O)NCc4ccc(F)cc4F)c(=O)c(O)c(n32)C1=O |
| InChI | InChI=1S/C20H19F2N3O4.C2H6/c1-2-24-9-12-5-6-14-15(17(26)18(27)16(20(24)29)25(12)14)19(28)23-8-10-3-4-11(21)7-13(10)22;1-2/h3-4,7,12,27H,2,5-6,8-9H2,1H3,(H,23,28);1-2H3/t12-;/m1./s1 |
| InChIKey | PZXCAVJPBYMYQZ-UTONKHPSSA-N |
| XLogP | 2.75 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |