C19H19F2N5O4 — CID 146205867
N-[(2,4-difluorophenyl)methyl]-2-hydrazinyl-9-hydroxy-6-methyl-7,10-dioxo-6,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),8-diene-11-carboxamide (PubChem CID 146205867) has the molecular formula C19H19F2N5O4 and a molecular weight of 419.39 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-2-hydrazinyl-9-hydroxy-6-methyl-7,10-dioxo-6,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),8-diene-11-carboxamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-2-hydrazinyl-9-hydroxy-6-methyl-7,10-dioxo-6,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),8-diene-11-carboxamide |
|---|---|
| PubChem CID | 146205867 |
| Molecular Formula | C19H19F2N5O4 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-2-hydrazinyl-9-hydroxy-6-methyl-7,10-dioxo-6,12-diazatricyclo[6.3.1.04,12]dodeca-1(11),8-diene-11-carboxamide |
| SMILES | CN1CC2CC(NN)c3c(C(=O)NCc4ccc(F)cc4F)c(=O)c(O)c(n32)C1=O |
| InChI | InChI=1S/C19H19F2N5O4/c1-25-7-10-5-12(24-22)14-13(16(27)17(28)15(19(25)30)26(10)14)18(29)23-6-8-2-3-9(20)4-11(8)21/h2-4,10,12,24,28H,5-7,22H2,1H3,(H,23,29) |
| InChIKey | VMMTVRIGOBCLBF-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 129.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|