C78H72F6N12O15 — CID 163897679
N-[(2,4-difluorophenyl)methyl]-5,8-dioxo-6-phenylmethoxy-12-oxa-1,2,9-triazatricyclo[7.5.1.02,7]pentadeca-3,6-diene-4-carboxamide (PubChem CID 163897679) has the molecular formula C78H72F6N12O15 and a molecular weight of 1531.49 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-5,8-dioxo-6-phenylmethoxy-12-oxa-1,2,9-triazatricyclo[7.5.1.02,7]pentadeca-3,6-diene-4-carboxamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-5,8-dioxo-6-phenylmethoxy-12-oxa-1,2,9-triazatricyclo[7.5.1.02,7]pentadeca-3,6-diene-4-carboxamide |
|---|---|
| PubChem CID | 163897679 |
| Molecular Formula | C78H72F6N12O15 |
| Molecular Weight | 1531.49 g/mol |
| Exact Mass | 1530.51 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-5,8-dioxo-6-phenylmethoxy-12-oxa-1,2,9-triazatricyclo[7.5.1.02,7]pentadeca-3,6-diene-4-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1F)c1cn2c(c(OCc3ccccc3)c1=O)C(=O)N1CCOCCN2C1.O=C(NCc1ccc(F)cc1F)c1cn2c(c(OCc3ccccc3)c1=O)C(=O)N1CCOCCN2C1.O=C(NCc1ccc(F)cc1F)c1cn2c(c(OCc3ccccc3)c1=O)C(=O)N1CCOCCN2C1 |
| InChI | InChI=1S/3C26H24F2N4O5/c3*27-19-7-6-18(21(28)12-19)13-29-25(34)20-14-32-22(26(35)30-8-10-36-11-9-31(32)16-30)24(23(20)33)37-15-17-4-2-1-3-5-17/h3*1-7,12,14H,8-11,13,15-16H2,(H,29,34) |
| InChIKey | QHCARNZJHZKBQX-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 279.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 111 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1531.49 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 21 |