C24H28F2N4O4 — CID 162484315
6-butoxy-N-[(2,4-difluorophenyl)methyl]-5,8-dioxo-1,2,9-triazatricyclo[7.5.1.02,7]pentadeca-3,6-diene-4-carboxamide (PubChem CID 162484315) has the molecular formula C24H28F2N4O4 and a molecular weight of 474.51 g/mol. Its IUPAC name is 6-butoxy-N-[(2,4-difluorophenyl)methyl]-5,8-dioxo-1,2,9-triazatricyclo[7.5.1.02,7]pentadeca-3,6-diene-4-carboxamide.
| Compound Name | 6-butoxy-N-[(2,4-difluorophenyl)methyl]-5,8-dioxo-1,2,9-triazatricyclo[7.5.1.02,7]pentadeca-3,6-diene-4-carboxamide |
|---|---|
| PubChem CID | 162484315 |
| Molecular Formula | C24H28F2N4O4 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 6-butoxy-N-[(2,4-difluorophenyl)methyl]-5,8-dioxo-1,2,9-triazatricyclo[7.5.1.02,7]pentadeca-3,6-diene-4-carboxamide |
| SMILES | CCCCOc1c2n(cc(C(=O)NCc3ccc(F)cc3F)c1=O)N1CCCCCN(C1)C2=O |
| InChI | InChI=1S/C24H28F2N4O4/c1-2-3-11-34-22-20-24(33)28-9-5-4-6-10-29(15-28)30(20)14-18(21(22)31)23(32)27-13-16-7-8-17(25)12-19(16)26/h7-8,12,14H,2-6,9-11,13,15H2,1H3,(H,27,32) |
| InChIKey | UUBGRZBATPILMP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|