C31H32F2N4O4 — CID 164590529
1-but-3-en-2-yl-N-[(2,4-difluorophenyl)methyl]-3-(2-methylbut-3-en-2-yl)-4,6-dioxo-5-phenylmethoxy-2H-pyrido[2,1-f][1,2,4]triazine-7-carboxamide (PubChem CID 164590529) has the molecular formula C31H32F2N4O4 and a molecular weight of 562.62 g/mol. Its IUPAC name is 1-but-3-en-2-yl-N-[(2,4-difluorophenyl)methyl]-3-(2-methylbut-3-en-2-yl)-4,6-dioxo-5-phenylmethoxy-2H-pyrido[2,1-f][1,2,4]triazine-7-carboxamide.
| Compound Name | 1-but-3-en-2-yl-N-[(2,4-difluorophenyl)methyl]-3-(2-methylbut-3-en-2-yl)-4,6-dioxo-5-phenylmethoxy-2H-pyrido[2,1-f][1,2,4]triazine-7-carboxamide |
|---|---|
| PubChem CID | 164590529 |
| Molecular Formula | C31H32F2N4O4 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | 1-but-3-en-2-yl-N-[(2,4-difluorophenyl)methyl]-3-(2-methylbut-3-en-2-yl)-4,6-dioxo-5-phenylmethoxy-2H-pyrido[2,1-f][1,2,4]triazine-7-carboxamide |
| SMILES | C=CC(C)N1CN(C(C)(C)C=C)C(=O)c2c(OCc3ccccc3)c(=O)c(C(=O)NCc3ccc(F)cc3F)cn21 |
| InChI | InChI=1S/C31H32F2N4O4/c1-6-20(3)37-19-35(31(4,5)7-2)30(40)26-28(41-18-21-11-9-8-10-12-21)27(38)24(17-36(26)37)29(39)34-16-22-13-14-23(32)15-25(22)33/h6-15,17,20H,1-2,16,18-19H2,3-5H3,(H,34,39) |
| InChIKey | ULTUXSGYAMFTEJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|