C25H23F2N3O5 — CID 164590637
1-(but-3-en-2-ylamino)-5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxypyridine-2-carboxylic acid (PubChem CID 164590637) has the molecular formula C25H23F2N3O5 and a molecular weight of 483.47 g/mol. Its IUPAC name is 1-(but-3-en-2-ylamino)-5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxypyridine-2-carboxylic acid.
| Compound Name | 1-(but-3-en-2-ylamino)-5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxypyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 164590637 |
| Molecular Formula | C25H23F2N3O5 |
| Molecular Weight | 483.47 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 1-(but-3-en-2-ylamino)-5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxypyridine-2-carboxylic acid |
| SMILES | C=CC(C)Nn1cc(C(=O)NCc2ccc(F)cc2F)c(=O)c(OCc2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C25H23F2N3O5/c1-3-15(2)29-30-13-19(24(32)28-12-17-9-10-18(26)11-20(17)27)22(31)23(21(30)25(33)34)35-14-16-7-5-4-6-8-16/h3-11,13,15,29H,1,12,14H2,2H3,(H,28,32)(H,33,34) |
| InChIKey | PMDUSPGXPUTVFH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|