C24H22F2N4O5 — CID 139426985
N-[(2,4-difluorophenyl)methyl]-3-(2-hydroxyethyl)-4,6-dioxo-5-phenylmethoxy-1,2-dihydropyrido[2,1-f][1,2,4]triazine-7-carboxamide (PubChem CID 139426985) has the molecular formula C24H22F2N4O5 and a molecular weight of 484.46 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-3-(2-hydroxyethyl)-4,6-dioxo-5-phenylmethoxy-1,2-dihydropyrido[2,1-f][1,2,4]triazine-7-carboxamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-3-(2-hydroxyethyl)-4,6-dioxo-5-phenylmethoxy-1,2-dihydropyrido[2,1-f][1,2,4]triazine-7-carboxamide |
|---|---|
| PubChem CID | 139426985 |
| Molecular Formula | C24H22F2N4O5 |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-3-(2-hydroxyethyl)-4,6-dioxo-5-phenylmethoxy-1,2-dihydropyrido[2,1-f][1,2,4]triazine-7-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1F)c1cn2c(c(OCc3ccccc3)c1=O)C(=O)N(CCO)CN2 |
| InChI | InChI=1S/C24H22F2N4O5/c25-17-7-6-16(19(26)10-17)11-27-23(33)18-12-30-20(24(34)29(8-9-31)14-28-30)22(21(18)32)35-13-15-4-2-1-3-5-15/h1-7,10,12,28,31H,8-9,11,13-14H2,(H,27,33) |
| InChIKey | NTDMITKVBAGXKS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |