C28H25F2N3O5 — CID 153440020
N-[(2,4-difluorophenyl)methyl]-2-methyl-7,10-dioxo-9-phenylmethoxy-3-oxa-6,15-diazatetracyclo[6.6.1.02,6.012,15]pentadeca-8,11-diene-11-carboxamide (PubChem CID 153440020) has the molecular formula C28H25F2N3O5 and a molecular weight of 521.52 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-2-methyl-7,10-dioxo-9-phenylmethoxy-3-oxa-6,15-diazatetracyclo[6.6.1.02,6.012,15]pentadeca-8,11-diene-11-carboxamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-2-methyl-7,10-dioxo-9-phenylmethoxy-3-oxa-6,15-diazatetracyclo[6.6.1.02,6.012,15]pentadeca-8,11-diene-11-carboxamide |
|---|---|
| PubChem CID | 153440020 |
| Molecular Formula | C28H25F2N3O5 |
| Molecular Weight | 521.52 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-2-methyl-7,10-dioxo-9-phenylmethoxy-3-oxa-6,15-diazatetracyclo[6.6.1.02,6.012,15]pentadeca-8,11-diene-11-carboxamide |
| SMILES | CC12OCCN1C(=O)c1c(OCc3ccccc3)c(=O)c(C(=O)NCc3ccc(F)cc3F)c3n1C2CC3 |
| InChI | InChI=1S/C28H25F2N3O5/c1-28-21-10-9-20-22(26(35)31-14-17-7-8-18(29)13-19(17)30)24(34)25(37-15-16-5-3-2-4-6-16)23(33(20)21)27(36)32(28)11-12-38-28/h2-8,13,21H,9-12,14-15H2,1H3,(H,31,35) |
| InChIKey | UUUUBMJPKWTOPA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |