C27H25F5N4O4 — CID 166862533
12,12-difluoro-5-hydroxy-8-oxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-1,2,9-triazatricyclo[7.5.1.02,7]pentadeca-3,6-diene-4-carboxamide (PubChem CID 166862533) has the molecular formula C27H25F5N4O4 and a molecular weight of 564.51 g/mol. Its IUPAC name is 12,12-difluoro-5-hydroxy-8-oxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-1,2,9-triazatricyclo[7.5.1.02,7]pentadeca-3,6-diene-4-carboxamide.
| Compound Name | 12,12-difluoro-5-hydroxy-8-oxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-1,2,9-triazatricyclo[7.5.1.02,7]pentadeca-3,6-diene-4-carboxamide |
|---|---|
| PubChem CID | 166862533 |
| Molecular Formula | C27H25F5N4O4 |
| Molecular Weight | 564.51 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | 12,12-difluoro-5-hydroxy-8-oxo-6-phenylmethoxy-N-[(2,4,6-trifluorophenyl)methyl]-1,2,9-triazatricyclo[7.5.1.02,7]pentadeca-3,6-diene-4-carboxamide |
| SMILES | O=C(NCc1c(F)cc(F)cc1F)C1=CN2C(=C(OCc3ccccc3)C1O)C(=O)N1CCC(F)(F)CCN2C1 |
| InChI | InChI=1S/C27H25F5N4O4/c28-17-10-20(29)18(21(30)11-17)12-33-25(38)19-13-36-22(24(23(19)37)40-14-16-4-2-1-3-5-16)26(39)34-8-6-27(31,32)7-9-35(36)15-34/h1-5,10-11,13,23,37H,6-9,12,14-15H2,(H,33,38) |
| InChIKey | YMDVQNYBOVPPQB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |