C18H16BrF2NO4 — CID 69452500
ethyl 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-5-fluorophenoxy]acetate (PubChem CID 69452500) has the molecular formula C18H16BrF2NO4 and a molecular weight of 428.23 g/mol. Its IUPAC name is ethyl 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-5-fluorophenoxy]acetate.
| Compound Name | ethyl 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-5-fluorophenoxy]acetate |
|---|---|
| PubChem CID | 69452500 |
| Molecular Formula | C18H16BrF2NO4 |
| Molecular Weight | 428.23 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | ethyl 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-5-fluorophenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(F)ccc1C(=O)NCc1ccc(Br)cc1F |
| InChI | InChI=1S/C18H16BrF2NO4/c1-2-25-17(23)10-26-16-8-13(20)5-6-14(16)18(24)22-9-11-3-4-12(19)7-15(11)21/h3-8H,2,9-10H2,1H3,(H,22,24) |
| InChIKey | URGNQYFLFRGDOM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.23 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |