C25H29BrF2N2O4 — CID 142035589
N-[(4-bromo-2-fluorophenyl)methyl]-2-[(E)-2-ethoxypent-2-enoxy]-4-fluoro-5-morpholin-4-ylbenzamide (PubChem CID 142035589) has the molecular formula C25H29BrF2N2O4 and a molecular weight of 539.42 g/mol. Its IUPAC name is N-[(4-bromo-2-fluorophenyl)methyl]-2-[(E)-2-ethoxypent-2-enoxy]-4-fluoro-5-morpholin-4-ylbenzamide.
| Compound Name | N-[(4-bromo-2-fluorophenyl)methyl]-2-[(E)-2-ethoxypent-2-enoxy]-4-fluoro-5-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 142035589 |
| Molecular Formula | C25H29BrF2N2O4 |
| Molecular Weight | 539.42 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | N-[(4-bromo-2-fluorophenyl)methyl]-2-[(E)-2-ethoxypent-2-enoxy]-4-fluoro-5-morpholin-4-ylbenzamide |
| SMILES | CC/C=C(\COc1cc(F)c(N2CCOCC2)cc1C(=O)NCc1ccc(Br)cc1F)OCC |
| InChI | InChI=1S/C25H29BrF2N2O4/c1-3-5-19(33-4-2)16-34-24-14-22(28)23(30-8-10-32-11-9-30)13-20(24)25(31)29-15-17-6-7-18(26)12-21(17)27/h5-7,12-14H,3-4,8-11,15-16H2,1-2H3,(H,29,31)/b19-5+ |
| InChIKey | OQNAKYYVCZABLX-PTXOJBNSSA-N |
| XLogP | 5.20 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.42 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|