C17H15BrFNO4S — CID 150413757
2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-3-methylsulfanylphenoxy]acetic acid (PubChem CID 150413757) has the molecular formula C17H15BrFNO4S and a molecular weight of 428.28 g/mol. Its IUPAC name is 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-3-methylsulfanylphenoxy]acetic acid.
| Compound Name | 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-3-methylsulfanylphenoxy]acetic acid |
|---|---|
| PubChem CID | 150413757 |
| Molecular Formula | C17H15BrFNO4S |
| Molecular Weight | 428.28 g/mol |
| Exact Mass | 426.99 |
| IUPAC Name | 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-3-methylsulfanylphenoxy]acetic acid |
| SMILES | CSc1cccc(OCC(=O)O)c1C(=O)NCc1ccc(Br)cc1F |
| InChI | InChI=1S/C17H15BrFNO4S/c1-25-14-4-2-3-13(24-9-15(21)22)16(14)17(23)20-8-10-5-6-11(18)7-12(10)19/h2-7H,8-9H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | HGIGHNZOQPLTAS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.28 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |