C24H24F2N2O5 — CID 171908519
5-[4-(2-aminoethyl)phenoxy]-N-(2,4-difluorophenyl)-2,3,4-trimethoxybenzamide (PubChem CID 171908519) has the molecular formula C24H24F2N2O5 and a molecular weight of 458.46 g/mol. Its IUPAC name is 5-[4-(2-aminoethyl)phenoxy]-N-(2,4-difluorophenyl)-2,3,4-trimethoxybenzamide.
| Compound Name | 5-[4-(2-aminoethyl)phenoxy]-N-(2,4-difluorophenyl)-2,3,4-trimethoxybenzamide |
|---|---|
| PubChem CID | 171908519 |
| Molecular Formula | C24H24F2N2O5 |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 5-[4-(2-aminoethyl)phenoxy]-N-(2,4-difluorophenyl)-2,3,4-trimethoxybenzamide |
| SMILES | COc1c(Oc2ccc(CCN)cc2)cc(C(=O)Nc2ccc(F)cc2F)c(OC)c1OC |
| InChI | InChI=1S/C24H24F2N2O5/c1-30-21-17(24(29)28-19-9-6-15(25)12-18(19)26)13-20(22(31-2)23(21)32-3)33-16-7-4-14(5-8-16)10-11-27/h4-9,12-13H,10-11,27H2,1-3H3,(H,28,29) |
| InChIKey | GVOBGMNOJTTYEL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |