C25H27ClN2O5 — CID 171386506
5-[4-(2-aminoethyl)phenoxy]-N-[(4-chlorophenyl)methyl]-2,3,4-trimethoxybenzamide (PubChem CID 171386506) has the molecular formula C25H27ClN2O5 and a molecular weight of 470.95 g/mol. Its IUPAC name is 5-[4-(2-aminoethyl)phenoxy]-N-[(4-chlorophenyl)methyl]-2,3,4-trimethoxybenzamide.
| Compound Name | 5-[4-(2-aminoethyl)phenoxy]-N-[(4-chlorophenyl)methyl]-2,3,4-trimethoxybenzamide |
|---|---|
| PubChem CID | 171386506 |
| Molecular Formula | C25H27ClN2O5 |
| Molecular Weight | 470.95 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 5-[4-(2-aminoethyl)phenoxy]-N-[(4-chlorophenyl)methyl]-2,3,4-trimethoxybenzamide |
| SMILES | COc1c(Oc2ccc(CCN)cc2)cc(C(=O)NCc2ccc(Cl)cc2)c(OC)c1OC |
| InChI | InChI=1S/C25H27ClN2O5/c1-30-22-20(25(29)28-15-17-4-8-18(26)9-5-17)14-21(23(31-2)24(22)32-3)33-19-10-6-16(7-11-19)12-13-27/h4-11,14H,12-13,15,27H2,1-3H3,(H,28,29) |
| InChIKey | AXZISNJLSURRHM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.95 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |