C23H26N2O5S — CID 171386529
5-[4-(2-aminoethyl)phenoxy]-2,3,4-trimethoxy-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 171386529) has the molecular formula C23H26N2O5S and a molecular weight of 442.54 g/mol. Its IUPAC name is 5-[4-(2-aminoethyl)phenoxy]-2,3,4-trimethoxy-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 5-[4-(2-aminoethyl)phenoxy]-2,3,4-trimethoxy-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 171386529 |
| Molecular Formula | C23H26N2O5S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 5-[4-(2-aminoethyl)phenoxy]-2,3,4-trimethoxy-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | COc1c(Oc2ccc(CCN)cc2)cc(C(=O)NCc2cccs2)c(OC)c1OC |
| InChI | InChI=1S/C23H26N2O5S/c1-27-20-18(23(26)25-14-17-5-4-12-31-17)13-19(21(28-2)22(20)29-3)30-16-8-6-15(7-9-16)10-11-24/h4-9,12-13H,10-11,14,24H2,1-3H3,(H,25,26) |
| InChIKey | PWGXAOMTKJEMKD-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |