C23H28N2O5 — CID 172674388
5-[4-(2-aminoethyl)phenoxy]-N-cyclopent-2-en-1-yl-2,3,4-trimethoxybenzamide (PubChem CID 172674388) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is 5-[4-(2-aminoethyl)phenoxy]-N-cyclopent-2-en-1-yl-2,3,4-trimethoxybenzamide.
| Compound Name | 5-[4-(2-aminoethyl)phenoxy]-N-cyclopent-2-en-1-yl-2,3,4-trimethoxybenzamide |
|---|---|
| PubChem CID | 172674388 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 5-[4-(2-aminoethyl)phenoxy]-N-cyclopent-2-en-1-yl-2,3,4-trimethoxybenzamide |
| SMILES | COc1c(Oc2ccc(CCN)cc2)cc(C(=O)NC2C=CCC2)c(OC)c1OC |
| InChI | InChI=1S/C23H28N2O5/c1-27-20-18(23(26)25-16-6-4-5-7-16)14-19(21(28-2)22(20)29-3)30-17-10-8-15(9-11-17)12-13-24/h4,6,8-11,14,16H,5,7,12-13,24H2,1-3H3,(H,25,26) |
| InChIKey | KGYKDFAYVJQFIR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|