C24H25ClN2O5 — CID 171910011
5-[4-(2-aminoethyl)phenoxy]-N-(3-chlorophenyl)-2,3,4-trimethoxybenzamide (PubChem CID 171910011) has the molecular formula C24H25ClN2O5 and a molecular weight of 456.93 g/mol. Its IUPAC name is 5-[4-(2-aminoethyl)phenoxy]-N-(3-chlorophenyl)-2,3,4-trimethoxybenzamide.
| Compound Name | 5-[4-(2-aminoethyl)phenoxy]-N-(3-chlorophenyl)-2,3,4-trimethoxybenzamide |
|---|---|
| PubChem CID | 171910011 |
| Molecular Formula | C24H25ClN2O5 |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 5-[4-(2-aminoethyl)phenoxy]-N-(3-chlorophenyl)-2,3,4-trimethoxybenzamide |
| SMILES | COc1c(Oc2ccc(CCN)cc2)cc(C(=O)Nc2cccc(Cl)c2)c(OC)c1OC |
| InChI | InChI=1S/C24H25ClN2O5/c1-29-21-19(24(28)27-17-6-4-5-16(25)13-17)14-20(22(30-2)23(21)31-3)32-18-9-7-15(8-10-18)11-12-26/h4-10,13-14H,11-12,26H2,1-3H3,(H,27,28) |
| InChIKey | XQKHCIGZOPRFGY-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |