C12H14N2O8 — CID 122417676
1-(2,2-dimethoxyethyl)-5-methoxy-4-oxo-6-(oxocarbamoyl)pyridine-3-carboxylic acid (PubChem CID 122417676) has the molecular formula C12H14N2O8 and a molecular weight of 314.25 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-5-methoxy-4-oxo-6-(oxocarbamoyl)pyridine-3-carboxylic acid.
| Compound Name | 1-(2,2-dimethoxyethyl)-5-methoxy-4-oxo-6-(oxocarbamoyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 122417676 |
| Molecular Formula | C12H14N2O8 |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-5-methoxy-4-oxo-6-(oxocarbamoyl)pyridine-3-carboxylic acid |
| SMILES | COc1c(C(=O)N=O)n(CC(OC)OC)cc(C(=O)O)c1=O |
| InChI | InChI=1S/C12H14N2O8/c1-20-7(21-2)5-14-4-6(12(17)18)9(15)10(22-3)8(14)11(16)13-19/h4,7H,5H2,1-3H3,(H,17,18) |
| InChIKey | OPMWRDSXCUBVJX-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|