C16H17NO5 — CID 19695842
1-(2,2-dimethoxyethyl)-2-oxo-6-phenylpyridine-3-carboxylic acid (PubChem CID 19695842) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-2-oxo-6-phenylpyridine-3-carboxylic acid.
| Compound Name | 1-(2,2-dimethoxyethyl)-2-oxo-6-phenylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 19695842 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-2-oxo-6-phenylpyridine-3-carboxylic acid |
| SMILES | COC(Cn1c(-c2ccccc2)ccc(C(=O)O)c1=O)OC |
| InChI | InChI=1S/C16H17NO5/c1-21-14(22-2)10-17-13(11-6-4-3-5-7-11)9-8-12(15(17)18)16(19)20/h3-9,14H,10H2,1-2H3,(H,19,20) |
| InChIKey | OYOYEZXOTCKIER-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|