C13H17NO9 — CID 129018252
methyl 5-carboxyoxy-1-(2,2-dimethoxyethyl)-3-methoxy-4-oxopyridine-2-carboxylate (PubChem CID 129018252) has the molecular formula C13H17NO9 and a molecular weight of 331.28 g/mol. Its IUPAC name is methyl 5-carboxyoxy-1-(2,2-dimethoxyethyl)-3-methoxy-4-oxopyridine-2-carboxylate.
| Compound Name | methyl 5-carboxyoxy-1-(2,2-dimethoxyethyl)-3-methoxy-4-oxopyridine-2-carboxylate |
|---|---|
| PubChem CID | 129018252 |
| Molecular Formula | C13H17NO9 |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | methyl 5-carboxyoxy-1-(2,2-dimethoxyethyl)-3-methoxy-4-oxopyridine-2-carboxylate |
| SMILES | COC(=O)c1c(OC)c(=O)c(OC(=O)O)cn1CC(OC)OC |
| InChI | InChI=1S/C13H17NO9/c1-19-8(20-2)6-14-5-7(23-13(17)18)10(15)11(21-3)9(14)12(16)22-4/h5,8H,6H2,1-4H3,(H,17,18) |
| InChIKey | SPQKKFHYBWBWEH-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|