C12H9ClFNO4 — CID 67847624
(7-chloro-1-ethyl-8-fluoro-4-oxoquinolin-3-yl) hydrogen carbonate (PubChem CID 67847624) has the molecular formula C12H9ClFNO4 and a molecular weight of 285.66 g/mol. Its IUPAC name is (7-chloro-1-ethyl-8-fluoro-4-oxoquinolin-3-yl) hydrogen carbonate.
| Compound Name | (7-chloro-1-ethyl-8-fluoro-4-oxoquinolin-3-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 67847624 |
| Molecular Formula | C12H9ClFNO4 |
| Molecular Weight | 285.66 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | (7-chloro-1-ethyl-8-fluoro-4-oxoquinolin-3-yl) hydrogen carbonate |
| SMILES | CCn1cc(OC(=O)O)c(=O)c2ccc(Cl)c(F)c21 |
| InChI | InChI=1S/C12H9ClFNO4/c1-2-15-5-8(19-12(17)18)11(16)6-3-4-7(13)9(14)10(6)15/h3-5H,2H2,1H3,(H,17,18) |
| InChIKey | KZGVXHNFNGAZIJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.66 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |