C18H11F4NO4 — CID 68559621
[8-fluoro-4-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]quinolin-3-yl] hydrogen carbonate (PubChem CID 68559621) has the molecular formula C18H11F4NO4 and a molecular weight of 381.28 g/mol. Its IUPAC name is [8-fluoro-4-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]quinolin-3-yl] hydrogen carbonate.
| Compound Name | [8-fluoro-4-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]quinolin-3-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 68559621 |
| Molecular Formula | C18H11F4NO4 |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | [8-fluoro-4-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]quinolin-3-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1cn(Cc2cccc(C(F)(F)F)c2)c2c(F)cccc2c1=O |
| InChI | InChI=1S/C18H11F4NO4/c19-13-6-2-5-12-15(13)23(9-14(16(12)24)27-17(25)26)8-10-3-1-4-11(7-10)18(20,21)22/h1-7,9H,8H2,(H,25,26) |
| InChIKey | BBPHJMSZCHLFSL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |