C25H22F3N3O — CID 54467660
2-(1-benzylindol-3-yl)-N'-[[3-(trifluoromethyl)phenyl]methyl]acetohydrazide (PubChem CID 54467660) has the molecular formula C25H22F3N3O and a molecular weight of 437.47 g/mol. Its IUPAC name is 2-(1-benzylindol-3-yl)-N'-[[3-(trifluoromethyl)phenyl]methyl]acetohydrazide.
| Compound Name | 2-(1-benzylindol-3-yl)-N'-[[3-(trifluoromethyl)phenyl]methyl]acetohydrazide |
|---|---|
| PubChem CID | 54467660 |
| Molecular Formula | C25H22F3N3O |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 2-(1-benzylindol-3-yl)-N'-[[3-(trifluoromethyl)phenyl]methyl]acetohydrazide |
| SMILES | O=C(Cc1cn(Cc2ccccc2)c2ccccc12)NNCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H22F3N3O/c26-25(27,28)21-10-6-9-19(13-21)15-29-30-24(32)14-20-17-31(16-18-7-2-1-3-8-18)23-12-5-4-11-22(20)23/h1-13,17,29H,14-16H2,(H,30,32) |
| InChIKey | XGBRXKGNORWMMU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|