C26H23F3N2O2 — CID 57248001
methyl 2-[(1-benzylindol-3-yl)methylamino]-2-[3-(trifluoromethyl)phenyl]acetate (PubChem CID 57248001) has the molecular formula C26H23F3N2O2 and a molecular weight of 452.48 g/mol. Its IUPAC name is methyl 2-[(1-benzylindol-3-yl)methylamino]-2-[3-(trifluoromethyl)phenyl]acetate.
| Compound Name | methyl 2-[(1-benzylindol-3-yl)methylamino]-2-[3-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 57248001 |
| Molecular Formula | C26H23F3N2O2 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | methyl 2-[(1-benzylindol-3-yl)methylamino]-2-[3-(trifluoromethyl)phenyl]acetate |
| SMILES | COC(=O)C(NCc1cn(Cc2ccccc2)c2ccccc12)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H23F3N2O2/c1-33-25(32)24(19-10-7-11-21(14-19)26(27,28)29)30-15-20-17-31(16-18-8-3-2-4-9-18)23-13-6-5-12-22(20)23/h2-14,17,24,30H,15-16H2,1H3 |
| InChIKey | FUJAFNYMXKQUEP-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |