C20H19F3N2O2 — CID 68813563
(2S)-2-(methylamino)-3-[1-[[4-(trifluoromethyl)phenyl]methyl]indol-3-yl]propanoic acid (PubChem CID 68813563) has the molecular formula C20H19F3N2O2 and a molecular weight of 376.38 g/mol. Its IUPAC name is (2S)-2-(methylamino)-3-[1-[[4-(trifluoromethyl)phenyl]methyl]indol-3-yl]propanoic acid.
| Compound Name | (2S)-2-(methylamino)-3-[1-[[4-(trifluoromethyl)phenyl]methyl]indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 68813563 |
| Molecular Formula | C20H19F3N2O2 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | (2S)-2-(methylamino)-3-[1-[[4-(trifluoromethyl)phenyl]methyl]indol-3-yl]propanoic acid |
| SMILES | CN[C@@H](Cc1cn(Cc2ccc(C(F)(F)F)cc2)c2ccccc12)C(=O)O |
| InChI | InChI=1S/C20H19F3N2O2/c1-24-17(19(26)27)10-14-12-25(18-5-3-2-4-16(14)18)11-13-6-8-15(9-7-13)20(21,22)23/h2-9,12,17,24H,10-11H2,1H3,(H,26,27)/t17-/m0/s1 |
| InChIKey | DFKLJJMOAMTZCZ-KRWDZBQOSA-N |
| XLogP | 3.92 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |