C19H20N2O2 — CID 14659443
methyl 2-amino-3-(1-benzylindol-3-yl)propanoate (PubChem CID 14659443) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is methyl 2-amino-3-(1-benzylindol-3-yl)propanoate.
| Compound Name | methyl 2-amino-3-(1-benzylindol-3-yl)propanoate |
|---|---|
| PubChem CID | 14659443 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | methyl 2-amino-3-(1-benzylindol-3-yl)propanoate |
| SMILES | COC(=O)C(N)Cc1cn(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C19H20N2O2/c1-23-19(22)17(20)11-15-13-21(12-14-7-3-2-4-8-14)18-10-6-5-9-16(15)18/h2-10,13,17H,11-12,20H2,1H3 |
| InChIKey | HGLYUTGPOMYFQT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |