C19H17F3N2O2 — CID 68815263
(2S)-2-amino-3-[1-[[4-(trifluoromethyl)phenyl]methyl]indol-3-yl]propanoic acid (PubChem CID 68815263) has the molecular formula C19H17F3N2O2 and a molecular weight of 362.35 g/mol. Its IUPAC name is (2S)-2-amino-3-[1-[[4-(trifluoromethyl)phenyl]methyl]indol-3-yl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[1-[[4-(trifluoromethyl)phenyl]methyl]indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 68815263 |
| Molecular Formula | C19H17F3N2O2 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | (2S)-2-amino-3-[1-[[4-(trifluoromethyl)phenyl]methyl]indol-3-yl]propanoic acid |
| SMILES | N[C@@H](Cc1cn(Cc2ccc(C(F)(F)F)cc2)c2ccccc12)C(=O)O |
| InChI | InChI=1S/C19H17F3N2O2/c20-19(21,22)14-7-5-12(6-8-14)10-24-11-13(9-16(23)18(25)26)15-3-1-2-4-17(15)24/h1-8,11,16H,9-10,23H2,(H,25,26)/t16-/m0/s1 |
| InChIKey | CAOWUQWLFZSVJE-INIZCTEOSA-N |
| XLogP | 3.66 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |