C19H16FN3O2 — CID 87585983
2-(cyanoamino)-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]propanoic acid (PubChem CID 87585983) has the molecular formula C19H16FN3O2 and a molecular weight of 337.35 g/mol. Its IUPAC name is 2-(cyanoamino)-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]propanoic acid.
| Compound Name | 2-(cyanoamino)-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 87585983 |
| Molecular Formula | C19H16FN3O2 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 2-(cyanoamino)-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]propanoic acid |
| SMILES | N#CNC(Cc1cn(Cc2ccc(F)cc2)c2ccccc12)C(=O)O |
| InChI | InChI=1S/C19H16FN3O2/c20-15-7-5-13(6-8-15)10-23-11-14(9-17(19(24)25)22-12-21)16-3-1-2-4-18(16)23/h1-8,11,17,22H,9-10H2,(H,24,25) |
| InChIKey | KTHCJADOXDHPDY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|