C24H20F2N4OS — CID 142763633
N-(4-fluorophenyl)-2-[2-[[1-[(4-fluorophenyl)methyl]indol-3-yl]methyl]hydrazinyl]-2-sulfanylideneacetamide (PubChem CID 142763633) has the molecular formula C24H20F2N4OS and a molecular weight of 450.51 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[2-[[1-[(4-fluorophenyl)methyl]indol-3-yl]methyl]hydrazinyl]-2-sulfanylideneacetamide.
| Compound Name | N-(4-fluorophenyl)-2-[2-[[1-[(4-fluorophenyl)methyl]indol-3-yl]methyl]hydrazinyl]-2-sulfanylideneacetamide |
|---|---|
| PubChem CID | 142763633 |
| Molecular Formula | C24H20F2N4OS |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | N-(4-fluorophenyl)-2-[2-[[1-[(4-fluorophenyl)methyl]indol-3-yl]methyl]hydrazinyl]-2-sulfanylideneacetamide |
| SMILES | O=C(Nc1ccc(F)cc1)C(=S)NNCc1cn(Cc2ccc(F)cc2)c2ccccc12 |
| InChI | InChI=1S/C24H20F2N4OS/c25-18-7-5-16(6-8-18)14-30-15-17(21-3-1-2-4-22(21)30)13-27-29-24(32)23(31)28-20-11-9-19(26)10-12-20/h1-12,15,27H,13-14H2,(H,28,31)(H,29,32) |
| InChIKey | UODYALRSOSFPEB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 58.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|