C25H22F2N4O2S — CID 142763626
N-(2,4-difluorophenyl)-2-[2-[[1-[(4-methoxyphenyl)methyl]indol-3-yl]methyl]hydrazinyl]-2-sulfanylideneacetamide (PubChem CID 142763626) has the molecular formula C25H22F2N4O2S and a molecular weight of 480.54 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-[2-[[1-[(4-methoxyphenyl)methyl]indol-3-yl]methyl]hydrazinyl]-2-sulfanylideneacetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-[2-[[1-[(4-methoxyphenyl)methyl]indol-3-yl]methyl]hydrazinyl]-2-sulfanylideneacetamide |
|---|---|
| PubChem CID | 142763626 |
| Molecular Formula | C25H22F2N4O2S |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-[2-[[1-[(4-methoxyphenyl)methyl]indol-3-yl]methyl]hydrazinyl]-2-sulfanylideneacetamide |
| SMILES | COc1ccc(Cn2cc(CNNC(=S)C(=O)Nc3ccc(F)cc3F)c3ccccc32)cc1 |
| InChI | InChI=1S/C25H22F2N4O2S/c1-33-19-9-6-16(7-10-19)14-31-15-17(20-4-2-3-5-23(20)31)13-28-30-25(34)24(32)29-22-11-8-18(26)12-21(22)27/h2-12,15,28H,13-14H2,1H3,(H,29,32)(H,30,34) |
| InChIKey | BYDJCWVFKXNJHJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 67.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|