C27H27FN2O2 — CID 154688026
4-[1-[(3-fluorophenyl)methyl]indol-3-yl]-N-[(3-methoxyphenyl)methyl]butanamide (PubChem CID 154688026) has the molecular formula C27H27FN2O2 and a molecular weight of 430.52 g/mol. Its IUPAC name is 4-[1-[(3-fluorophenyl)methyl]indol-3-yl]-N-[(3-methoxyphenyl)methyl]butanamide.
| Compound Name | 4-[1-[(3-fluorophenyl)methyl]indol-3-yl]-N-[(3-methoxyphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 154688026 |
| Molecular Formula | C27H27FN2O2 |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 4-[1-[(3-fluorophenyl)methyl]indol-3-yl]-N-[(3-methoxyphenyl)methyl]butanamide |
| SMILES | COc1cccc(CNC(=O)CCCc2cn(Cc3cccc(F)c3)c3ccccc23)c1 |
| InChI | InChI=1S/C27H27FN2O2/c1-32-24-11-5-7-20(16-24)17-29-27(31)14-6-9-22-19-30(26-13-3-2-12-25(22)26)18-21-8-4-10-23(28)15-21/h2-5,7-8,10-13,15-16,19H,6,9,14,17-18H2,1H3,(H,29,31) |
| InChIKey | QIDYLXRVEBAIEQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |