C27H28N2O3 — CID 4616420
3-(1-benzylindol-3-yl)-N-[(2,5-dimethoxyphenyl)methyl]propanamide (PubChem CID 4616420) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is 3-(1-benzylindol-3-yl)-N-[(2,5-dimethoxyphenyl)methyl]propanamide.
| Compound Name | 3-(1-benzylindol-3-yl)-N-[(2,5-dimethoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 4616420 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 3-(1-benzylindol-3-yl)-N-[(2,5-dimethoxyphenyl)methyl]propanamide |
| SMILES | COc1ccc(OC)c(CNC(=O)CCc2cn(Cc3ccccc3)c3ccccc23)c1 |
| InChI | InChI=1S/C27H28N2O3/c1-31-23-13-14-26(32-2)22(16-23)17-28-27(30)15-12-21-19-29(18-20-8-4-3-5-9-20)25-11-7-6-10-24(21)25/h3-11,13-14,16,19H,12,15,17-18H2,1-2H3,(H,28,30) |
| InChIKey | FPRBMSUZTHZAGZ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |