C25H24N2O3 — CID 11718287
1-benzyl-N-[(2,4-dimethoxyphenyl)methyl]indole-3-carboxamide (PubChem CID 11718287) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is 1-benzyl-N-[(2,4-dimethoxyphenyl)methyl]indole-3-carboxamide.
| Compound Name | 1-benzyl-N-[(2,4-dimethoxyphenyl)methyl]indole-3-carboxamide |
|---|---|
| PubChem CID | 11718287 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 1-benzyl-N-[(2,4-dimethoxyphenyl)methyl]indole-3-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2cn(Cc3ccccc3)c3ccccc23)c(OC)c1 |
| InChI | InChI=1S/C25H24N2O3/c1-29-20-13-12-19(24(14-20)30-2)15-26-25(28)22-17-27(16-18-8-4-3-5-9-18)23-11-7-6-10-21(22)23/h3-14,17H,15-16H2,1-2H3,(H,26,28) |
| InChIKey | XKPOBXGDICSLKW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |