C25H29N3O6 — CID 46834191
N-[(2,4-dimethoxyphenyl)methyl]-1-[6-(hydroxyamino)-6-oxohexyl]-4-oxoquinoline-3-carboxamide (PubChem CID 46834191) has the molecular formula C25H29N3O6 and a molecular weight of 467.52 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-1-[6-(hydroxyamino)-6-oxohexyl]-4-oxoquinoline-3-carboxamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-1-[6-(hydroxyamino)-6-oxohexyl]-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 46834191 |
| Molecular Formula | C25H29N3O6 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-1-[6-(hydroxyamino)-6-oxohexyl]-4-oxoquinoline-3-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2cn(CCCCCC(=O)NO)c3ccccc3c2=O)c(OC)c1 |
| InChI | InChI=1S/C25H29N3O6/c1-33-18-12-11-17(22(14-18)34-2)15-26-25(31)20-16-28(13-7-3-4-10-23(29)27-32)21-9-6-5-8-19(21)24(20)30/h5-6,8-9,11-12,14,16,32H,3-4,7,10,13,15H2,1-2H3,(H,26,31)(H,27,29) |
| InChIKey | PJMISCCUVUVGOC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|