C24H26FN3O5 — CID 46834468
6-fluoro-1-[6-(hydroxyamino)-6-oxohexyl]-N-[(4-methoxyphenyl)methyl]-4-oxoquinoline-3-carboxamide (PubChem CID 46834468) has the molecular formula C24H26FN3O5 and a molecular weight of 455.49 g/mol. Its IUPAC name is 6-fluoro-1-[6-(hydroxyamino)-6-oxohexyl]-N-[(4-methoxyphenyl)methyl]-4-oxoquinoline-3-carboxamide.
| Compound Name | 6-fluoro-1-[6-(hydroxyamino)-6-oxohexyl]-N-[(4-methoxyphenyl)methyl]-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 46834468 |
| Molecular Formula | C24H26FN3O5 |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 6-fluoro-1-[6-(hydroxyamino)-6-oxohexyl]-N-[(4-methoxyphenyl)methyl]-4-oxoquinoline-3-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2cn(CCCCCC(=O)NO)c3ccc(F)cc3c2=O)cc1 |
| InChI | InChI=1S/C24H26FN3O5/c1-33-18-9-6-16(7-10-18)14-26-24(31)20-15-28(12-4-2-3-5-22(29)27-32)21-11-8-17(25)13-19(21)23(20)30/h6-11,13,15,32H,2-5,12,14H2,1H3,(H,26,31)(H,27,29) |
| InChIKey | KSMNMURZRNTSCF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|