C25H29N3O5 — CID 46831614
N-(2,4-dimethylphenyl)-1-[6-(hydroxyamino)-6-oxohexyl]-6-methoxy-4-oxoquinoline-3-carboxamide (PubChem CID 46831614) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-1-[6-(hydroxyamino)-6-oxohexyl]-6-methoxy-4-oxoquinoline-3-carboxamide.
| Compound Name | N-(2,4-dimethylphenyl)-1-[6-(hydroxyamino)-6-oxohexyl]-6-methoxy-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 46831614 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | N-(2,4-dimethylphenyl)-1-[6-(hydroxyamino)-6-oxohexyl]-6-methoxy-4-oxoquinoline-3-carboxamide |
| SMILES | COc1ccc2c(c1)c(=O)c(C(=O)Nc1ccc(C)cc1C)cn2CCCCCC(=O)NO |
| InChI | InChI=1S/C25H29N3O5/c1-16-8-10-21(17(2)13-16)26-25(31)20-15-28(12-6-4-5-7-23(29)27-32)22-11-9-18(33-3)14-19(22)24(20)30/h8-11,13-15,32H,4-7,12H2,1-3H3,(H,26,31)(H,27,29) |
| InChIKey | GINURGKOBDPFCL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|