C31H34N4O4 — CID 46833317
1-[6-(2-aminoanilino)-6-oxohexyl]-N-(2,4-dimethylphenyl)-6-methoxy-4-oxoquinoline-3-carboxamide (PubChem CID 46833317) has the molecular formula C31H34N4O4 and a molecular weight of 526.64 g/mol. Its IUPAC name is 1-[6-(2-aminoanilino)-6-oxohexyl]-N-(2,4-dimethylphenyl)-6-methoxy-4-oxoquinoline-3-carboxamide.
| Compound Name | 1-[6-(2-aminoanilino)-6-oxohexyl]-N-(2,4-dimethylphenyl)-6-methoxy-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 46833317 |
| Molecular Formula | C31H34N4O4 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | 1-[6-(2-aminoanilino)-6-oxohexyl]-N-(2,4-dimethylphenyl)-6-methoxy-4-oxoquinoline-3-carboxamide |
| SMILES | COc1ccc2c(c1)c(=O)c(C(=O)Nc1ccc(C)cc1C)cn2CCCCCC(=O)Nc1ccccc1N |
| InChI | InChI=1S/C31H34N4O4/c1-20-12-14-26(21(2)17-20)34-31(38)24-19-35(28-15-13-22(39-3)18-23(28)30(24)37)16-8-4-5-11-29(36)33-27-10-7-6-9-25(27)32/h6-7,9-10,12-15,17-19H,4-5,8,11,16,32H2,1-3H3,(H,33,36)(H,34,38) |
| InChIKey | GURMBGALDUELBN-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 115.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|