C25H26N4O5S — CID 46830727
N-(6-ethoxy-1,3-benzothiazol-2-yl)-1-[6-(hydroxyamino)-6-oxohexyl]-4-oxoquinoline-3-carboxamide (PubChem CID 46830727) has the molecular formula C25H26N4O5S and a molecular weight of 494.57 g/mol. Its IUPAC name is N-(6-ethoxy-1,3-benzothiazol-2-yl)-1-[6-(hydroxyamino)-6-oxohexyl]-4-oxoquinoline-3-carboxamide.
| Compound Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-1-[6-(hydroxyamino)-6-oxohexyl]-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 46830727 |
| Molecular Formula | C25H26N4O5S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-1-[6-(hydroxyamino)-6-oxohexyl]-4-oxoquinoline-3-carboxamide |
| SMILES | CCOc1ccc2nc(NC(=O)c3cn(CCCCCC(=O)NO)c4ccccc4c3=O)sc2c1 |
| InChI | InChI=1S/C25H26N4O5S/c1-2-34-16-11-12-19-21(14-16)35-25(26-19)27-24(32)18-15-29(13-7-3-4-10-22(30)28-33)20-9-6-5-8-17(20)23(18)31/h5-6,8-9,11-12,14-15,33H,2-4,7,10,13H2,1H3,(H,28,30)(H,26,27,32) |
| InChIKey | SOGGCRLZZXVDFU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|