C26H31N3O4 — CID 46830422
N-(4-tert-butylphenyl)-1-[6-(hydroxyamino)-6-oxohexyl]-4-oxoquinoline-3-carboxamide (PubChem CID 46830422) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-1-[6-(hydroxyamino)-6-oxohexyl]-4-oxoquinoline-3-carboxamide.
| Compound Name | N-(4-tert-butylphenyl)-1-[6-(hydroxyamino)-6-oxohexyl]-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 46830422 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | N-(4-tert-butylphenyl)-1-[6-(hydroxyamino)-6-oxohexyl]-4-oxoquinoline-3-carboxamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)c2cn(CCCCCC(=O)NO)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C26H31N3O4/c1-26(2,3)18-12-14-19(15-13-18)27-25(32)21-17-29(16-8-4-5-11-23(30)28-33)22-10-7-6-9-20(22)24(21)31/h6-7,9-10,12-15,17,33H,4-5,8,11,16H2,1-3H3,(H,27,32)(H,28,30) |
| InChIKey | DRSAXVFZFGBRMV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|