C21H28N2O3 — CID 71019902
N-(3,3-dimethyl-2-oxobutyl)-4-oxo-1-pentylquinoline-3-carboxamide (PubChem CID 71019902) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is N-(3,3-dimethyl-2-oxobutyl)-4-oxo-1-pentylquinoline-3-carboxamide.
| Compound Name | N-(3,3-dimethyl-2-oxobutyl)-4-oxo-1-pentylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 71019902 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | N-(3,3-dimethyl-2-oxobutyl)-4-oxo-1-pentylquinoline-3-carboxamide |
| SMILES | CCCCCn1cc(C(=O)NCC(=O)C(C)(C)C)c(=O)c2ccccc21 |
| InChI | InChI=1S/C21H28N2O3/c1-5-6-9-12-23-14-16(19(25)15-10-7-8-11-17(15)23)20(26)22-13-18(24)21(2,3)4/h7-8,10-11,14H,5-6,9,12-13H2,1-4H3,(H,22,26) |
| InChIKey | RGPXOZFVGHVTDF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|