C23H28N2S — CID 86274399
1-pentyl-N-(2-phenylpropan-2-yl)indole-3-carbothioamide (PubChem CID 86274399) has the molecular formula C23H28N2S and a molecular weight of 364.56 g/mol. Its IUPAC name is 1-pentyl-N-(2-phenylpropan-2-yl)indole-3-carbothioamide.
| Compound Name | 1-pentyl-N-(2-phenylpropan-2-yl)indole-3-carbothioamide |
|---|---|
| PubChem CID | 86274399 |
| Molecular Formula | C23H28N2S |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 1-pentyl-N-(2-phenylpropan-2-yl)indole-3-carbothioamide |
| SMILES | CCCCCn1cc(C(=S)NC(C)(C)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C23H28N2S/c1-4-5-11-16-25-17-20(19-14-9-10-15-21(19)25)22(26)24-23(2,3)18-12-7-6-8-13-18/h6-10,12-15,17H,4-5,11,16H2,1-3H3,(H,24,26) |
| InChIKey | ZRMKJHUTIZIQQY-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|