C28H26N2 — CID 102432430
(Z)-3-(1-pentylindol-3-yl)-2,3-diphenylprop-2-enenitrile (PubChem CID 102432430) has the molecular formula C28H26N2 and a molecular weight of 390.53 g/mol. Its IUPAC name is (Z)-3-(1-pentylindol-3-yl)-2,3-diphenylprop-2-enenitrile.
| Compound Name | (Z)-3-(1-pentylindol-3-yl)-2,3-diphenylprop-2-enenitrile |
|---|---|
| PubChem CID | 102432430 |
| Molecular Formula | C28H26N2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | (Z)-3-(1-pentylindol-3-yl)-2,3-diphenylprop-2-enenitrile |
| SMILES | CCCCCn1cc(/C(=C(\C#N)c2ccccc2)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C28H26N2/c1-2-3-12-19-30-21-26(24-17-10-11-18-27(24)30)28(23-15-8-5-9-16-23)25(20-29)22-13-6-4-7-14-22/h4-11,13-18,21H,2-3,12,19H2,1H3/b28-25+ |
| InChIKey | ZDAKAGWYCLHPCX-AZPGRJICSA-N |
| XLogP | 7.31 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|