C24H18N2 — CID 102432423
(Z)-3-(1-methylindol-3-yl)-2,3-diphenylprop-2-enenitrile (PubChem CID 102432423) has the molecular formula C24H18N2 and a molecular weight of 334.42 g/mol. Its IUPAC name is (Z)-3-(1-methylindol-3-yl)-2,3-diphenylprop-2-enenitrile.
| Compound Name | (Z)-3-(1-methylindol-3-yl)-2,3-diphenylprop-2-enenitrile |
|---|---|
| PubChem CID | 102432423 |
| Molecular Formula | C24H18N2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (Z)-3-(1-methylindol-3-yl)-2,3-diphenylprop-2-enenitrile |
| SMILES | Cn1cc(/C(=C(\C#N)c2ccccc2)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C24H18N2/c1-26-17-22(20-14-8-9-15-23(20)26)24(19-12-6-3-7-13-19)21(16-25)18-10-4-2-5-11-18/h2-15,17H,1H3/b24-21+ |
| InChIKey | DKYJZRUOYKKHPZ-DARPEHSRSA-N |
| XLogP | 5.66 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|