C23H19N — CID 177384504
(Z)-2,3-bis(4-methylphenyl)-3-phenylprop-2-enenitrile (PubChem CID 177384504) has the molecular formula C23H19N and a molecular weight of 309.41 g/mol. Its IUPAC name is (Z)-2,3-bis(4-methylphenyl)-3-phenylprop-2-enenitrile.
| Compound Name | (Z)-2,3-bis(4-methylphenyl)-3-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 177384504 |
| Molecular Formula | C23H19N |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (Z)-2,3-bis(4-methylphenyl)-3-phenylprop-2-enenitrile |
| SMILES | Cc1ccc(/C(C#N)=C(\c2ccccc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H19N/c1-17-8-12-19(13-9-17)22(16-24)23(20-6-4-3-5-7-20)21-14-10-18(2)11-15-21/h3-15H,1-2H3/b23-22+ |
| InChIKey | MALFVUROMANLLG-GHVJWSGMSA-N |
| XLogP | 5.79 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|