C33H20Br2N2 — CID 132522260
2-[4-(3,6-dibromocarbazol-9-yl)phenyl]-3,3-diphenylprop-2-enenitrile (PubChem CID 132522260) has the molecular formula C33H20Br2N2 and a molecular weight of 604.35 g/mol. Its IUPAC name is 2-[4-(3,6-dibromocarbazol-9-yl)phenyl]-3,3-diphenylprop-2-enenitrile.
| Compound Name | 2-[4-(3,6-dibromocarbazol-9-yl)phenyl]-3,3-diphenylprop-2-enenitrile |
|---|---|
| PubChem CID | 132522260 |
| Molecular Formula | C33H20Br2N2 |
| Molecular Weight | 604.35 g/mol |
| Exact Mass | 602.00 |
| IUPAC Name | 2-[4-(3,6-dibromocarbazol-9-yl)phenyl]-3,3-diphenylprop-2-enenitrile |
| SMILES | N#CC(=C(c1ccccc1)c1ccccc1)c1ccc(-n2c3ccc(Br)cc3c3cc(Br)ccc32)cc1 |
| InChI | InChI=1S/C33H20Br2N2/c34-25-13-17-31-28(19-25)29-20-26(35)14-18-32(29)37(31)27-15-11-22(12-16-27)30(21-36)33(23-7-3-1-4-8-23)24-9-5-2-6-10-24/h1-20H |
| InChIKey | JPPASRIOOYYEDK-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.35 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|